CAS 1227502-36-4
:4-Cyano-3-(trifluoromethyl)benzoic acid
Description:
4-Cyano-3-(trifluoromethyl)benzoic acid is an aromatic compound characterized by the presence of a cyano group (-CN) and a trifluoromethyl group (-CF3) attached to a benzoic acid structure. This compound typically exhibits a white to off-white crystalline appearance and is known for its relatively high stability due to the strength of the carbon-fluorine bonds in the trifluoromethyl group. The cyano group contributes to its polarity and can enhance its reactivity in various chemical reactions, such as nucleophilic substitutions. The presence of both electron-withdrawing groups (the cyano and trifluoromethyl groups) influences the acidity of the carboxylic acid functional group, making it a stronger acid compared to benzoic acid. This compound is often utilized in organic synthesis and materials science, particularly in the development of pharmaceuticals and agrochemicals. Its unique electronic properties and functional groups make it a valuable intermediate in various chemical processes. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C9H4F3NO2
InChI:InChI=1S/C9H4F3NO2/c10-9(11,12)7-3-5(8(14)15)1-2-6(7)4-13/h1-3H,(H,14,15)
InChI key:InChIKey=MLKHYEZBRDXLEK-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(C#N)C=CC(C(O)=O)=C1
Synonyms:- Benzoic acid, 4-cyano-3-(trifluoromethyl)-
- 4-Cyano-3-(trifluoromethyl)benzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
4-Cyano-3-(trifluoromethyl)benzoic acid
CAS:4-Cyano-3-(trifluoromethyl)benzoic acid (4CBA) is a chemical compound that exhibits a high uptake by cells. It is used in the treatment of infectious diseases and has been shown to be active against viruses, such as HIV, and bacteria, such as Mycobacterium tuberculosis. 4CBA is chemically stable in human serum or plasma and can be prepared using caffeine or theophylline as an internal standard. This agent can also be used for diagnosis of various chemical substances in biological samples and is suitable for sample preparation. The 4CBA monomer has been electropolymerized on a solid phase microextraction (SPME) fiber to form a microsphere with an average diameter of 5μm.
Formula:C9H4F3NO2Purity:Min. 95%Molecular weight:215.13 g/mol
