CymitQuimica logo

CAS 1227502-63-7

:

4-Chloro-2-fluoro-5-methoxypyridine

Description:
4-Chloro-2-fluoro-5-methoxypyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of chlorine and fluorine substituents at the 4 and 2 positions, respectively, along with a methoxy group at the 5 position, contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It exhibits moderate polarity due to the electronegative halogen atoms and the methoxy group, which can influence its solubility in various organic solvents. The presence of these functional groups also suggests potential reactivity in nucleophilic substitution reactions and may serve as a building block in the synthesis of more complex molecules, particularly in pharmaceutical chemistry. Additionally, its structural features may impart specific biological activities, making it of interest in medicinal chemistry and agrochemical applications. Safety data should be consulted for handling and storage, as halogenated compounds can pose health and environmental risks.
Formula:C6H5ClFNO
InChI:InChI=1S/C6H5ClFNO/c1-10-5-3-9-6(8)2-4(5)7/h2-3H,1H3
InChI key:InChIKey=OSQIIXLSORZFTP-UHFFFAOYSA-N
SMILES:O(C)C=1C(Cl)=CC(F)=NC1
Synonyms:
  • Pyridine, 4-chloro-2-fluoro-5-methoxy-
  • 4-Chloro-2-fluoro-5-methoxypyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.