
CAS 1227508-34-0
:4-Hydroxy-2-pyridineacetonitrile
Description:
4-Hydroxy-2-pyridineacetonitrile, with the CAS number 1227508-34-0, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a hydroxyl group (-OH) and a nitrile group (-C≡N) attached to the pyridine ring, contributing to its chemical reactivity and potential applications. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the hydroxyl group. The compound's functional groups suggest it may participate in hydrogen bonding, influencing its physical properties such as melting and boiling points. Additionally, 4-Hydroxy-2-pyridineacetonitrile may be of interest in pharmaceutical research and synthesis due to its potential biological activity and ability to serve as a building block in the development of various chemical entities. Its specific reactivity and applications would depend on the context of its use in chemical synthesis or medicinal chemistry.
Formula:C7H6N2O
InChI:InChI=1S/C7H6N2O/c8-3-1-6-5-7(10)2-4-9-6/h2,4-5H,1H2,(H,9,10)
InChI key:InChIKey=CFHFHTDIDFXZFN-UHFFFAOYSA-N
SMILES:C(C#N)C1=CC(O)=CC=N1
Synonyms:- 4-Hydroxy-2-pyridineacetonitrile
- 2-Pyridineacetonitrile, 4-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.