
CAS 1227508-36-2
:Ethyl 2-amino-4-(trifluoromethyl)-3-pyridinecarboxylate
Description:
Ethyl 2-amino-4-(trifluoromethyl)-3-pyridinecarboxylate is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an ethyl ester functional group, an amino group, and a trifluoromethyl substituent, which significantly influences its chemical properties and reactivity. The presence of the trifluoromethyl group enhances lipophilicity and can affect the compound's biological activity, making it of interest in pharmaceutical research. The amino group can participate in hydrogen bonding, influencing solubility and interaction with biological targets. Ethyl 2-amino-4-(trifluoromethyl)-3-pyridinecarboxylate may exhibit various properties such as moderate to high stability under standard conditions, and it may be sensitive to hydrolysis due to the ester functionality. Its unique structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. As with any chemical substance, proper handling and safety measures should be observed due to potential toxicity or reactivity.
Formula:C9H9F3N2O2
InChI:InChI=1S/C9H9F3N2O2/c1-2-16-8(15)6-5(9(10,11)12)3-4-14-7(6)13/h3-4H,2H2,1H3,(H2,13,14)
InChI key:InChIKey=SRFCTGGTWSOJEW-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C(C(F)(F)F)=CC=NC1N
Synonyms:- Ethyl 2-amino-4-(trifluoromethyl)-3-pyridinecarboxylate
- 3-Pyridinecarboxylic acid, 2-amino-4-(trifluoromethyl)-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.