
CAS 1227513-82-7
:2,3-Dichloro-4-pyridineacetonitrile
Description:
2,3-Dichloro-4-pyridineacetonitrile is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features two chlorine substituents at the 2 and 3 positions of the pyridine ring, and a cyano group (-C≡N) attached to the 4-position via an acetonitrile linkage. It is typically a colorless to pale yellow solid or liquid, depending on its form and purity. The presence of chlorine atoms contributes to its reactivity and potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The cyano group enhances its polarity and solubility in polar solvents, making it useful in various chemical reactions. Additionally, the compound may exhibit biological activity, which can be of interest in medicinal chemistry. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, 2,3-Dichloro-4-pyridineacetonitrile is a versatile compound with significant implications in chemical research and industry.
Formula:C7H4Cl2N2
InChI:InChI=1S/C7H4Cl2N2/c8-6-5(1-3-10)2-4-11-7(6)9/h2,4H,1H2
InChI key:InChIKey=XBHQMTDCHXXGMS-UHFFFAOYSA-N
SMILES:C(C#N)C=1C(Cl)=C(Cl)N=CC1
Synonyms:- 4-Pyridineacetonitrile, 2,3-dichloro-
- 2,3-Dichloro-4-pyridineacetonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.