CymitQuimica logo

CAS 1227513-92-9

:

5-Bromo-3-hydroxy-2-pyridinemethanol

Description:
5-Bromo-3-hydroxy-2-pyridinemethanol is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 5-position and a hydroxyl group at the 3-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the hydroxyl group, which can engage in hydrogen bonding. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the functional groups may influence biological activity. Additionally, the bromine substituent can enhance reactivity in various chemical reactions, making it a useful intermediate in organic synthesis. The compound's CAS number, 1227513-92-9, allows for precise identification in chemical databases and literature. Overall, 5-Bromo-3-hydroxy-2-pyridinemethanol is notable for its structural features and potential utility in various chemical applications.
Formula:C6H6BrNO2
InChI:InChI=1S/C6H6BrNO2/c7-4-1-6(10)5(3-9)8-2-4/h1-2,9-10H,3H2
InChI key:InChIKey=OKCKXRANMMOMEW-UHFFFAOYSA-N
SMILES:C(O)C1=C(O)C=C(Br)C=N1
Synonyms:
  • 2-Pyridinemethanol, 5-bromo-3-hydroxy-
  • 5-Bromo-3-hydroxy-2-pyridinemethanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.