CymitQuimica logo

CAS 1227514-01-3

:

1,2-Dihydro-4-methyl-2-oxo-3-pyridineacetonitrile

Description:
1,2-Dihydro-4-methyl-2-oxo-3-pyridineacetonitrile, identified by its CAS number 1227514-01-3, is a chemical compound that features a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound is characterized by the presence of a ketone functional group (2-oxo) and a nitrile group (acetonitrile), contributing to its reactivity and potential applications in organic synthesis. The presence of the methyl group at the 4-position of the pyridine ring influences its electronic properties and steric hindrance. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry. Additionally, the structural features suggest potential for hydrogen bonding and interactions with other molecules, which can be relevant in various chemical reactions or biological systems. Overall, this compound's unique structure and functional groups position it as a valuable entity for further research and application in chemical and pharmaceutical contexts.
Formula:C8H8N2O
InChI:InChI=1S/C8H8N2O/c1-6-3-5-10-8(11)7(6)2-4-9/h3,5H,2H2,1H3,(H,10,11)
InChI key:InChIKey=VIWWOGQIIKOSPT-UHFFFAOYSA-N
SMILES:C(C#N)C1=C(C)C=CNC1=O
Synonyms:
  • 1,2-Dihydro-4-methyl-2-oxo-3-pyridineacetonitrile
  • 3-Pyridineacetonitrile, 1,2-dihydro-4-methyl-2-oxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.