CAS 1227514-35-3

2,5-Difluoro-4-pyridineacetonitrile

Description:

2,5-Difluoro-4-pyridineacetonitrile is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of two fluorine atoms at the 2 and 5 positions of the pyridine ring contributes to its unique reactivity and physical properties, such as increased electronegativity and potential for hydrogen bonding. The acetonitrile functional group, attached at the 4-position, introduces a nitrile (-C≡N) group, which is known for its polar character and ability to participate in various chemical reactions, including nucleophilic additions. This compound is typically a colorless to pale yellow liquid or solid, depending on its form, and is soluble in polar organic solvents. Its applications may include use in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. As with many fluorinated compounds, it may exhibit distinct biological activity and environmental behavior, necessitating careful handling and consideration of safety protocols.

Formula: C₇H₄F₂N₂

InChI: InChI=1S/C7H4F2N2/c8-6-4-11-7(9)3-5(6)1-2-10/h3-4H,1H2

InChI key: InChIKey=ITEUAEXJHRDPOS-UHFFFAOYSA-N

SMILES: C(C#N)C=1C(F)=CN=C(F)C1

Synonyms:

• 2,5-Difluoro-4-pyridineacetonitrile
• 4-Pyridineacetonitrile, 2,5-difluoro-