CAS 1227514-45-5

2-Amino-5-bromo-4-pyridinecarboxaldehyde

Description:

2-Amino-5-bromo-4-pyridinecarboxaldehyde is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of an amino group (-NH2) and a bromine atom at specific positions on the pyridine ring contributes to its reactivity and potential applications in various chemical reactions. The aldehyde functional group (-CHO) at the 4-position makes it a versatile intermediate in organic synthesis, allowing for further transformations such as condensation reactions. This compound is typically used in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals due to its ability to participate in nucleophilic addition and substitution reactions. Its physical properties, such as solubility and melting point, can vary based on the specific conditions and purity of the compound. Safety data should be consulted, as the presence of bromine and the amino group may pose certain hazards, necessitating appropriate handling and storage precautions.

Formula: C₆H₅BrN₂O

InChI: InChI=1S/C6H5BrN2O/c7-5-2-9-6(8)1-4(5)3-10/h1-3H,(H2,8,9)

InChI key: InChIKey=ROXOZQZSLLXFQY-UHFFFAOYSA-N

SMILES: C(=O)C=1C(Br)=CN=C(N)C1

Synonyms:

• 4-Pyridinecarboxaldehyde, 2-amino-5-bromo-
• 2-Amino-5-bromo-4-pyridinecarboxaldehyde