CymitQuimica logo

CAS 1227514-93-3

:

4-(Trifluoromethyl)-3-pyridineacetonitrile

Description:
4-(Trifluoromethyl)-3-pyridineacetonitrile, identified by its CAS number 1227514-93-3, is a chemical compound characterized by the presence of a pyridine ring substituted with a trifluoromethyl group and a nitrile functional group. This compound typically exhibits a polar nature due to the electronegative trifluoromethyl group, which can influence its solubility and reactivity. The nitrile group contributes to its potential as a versatile building block in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The presence of the pyridine moiety may impart basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Additionally, the trifluoromethyl group is known for enhancing the lipophilicity and metabolic stability of compounds, making them more effective in biological applications. Overall, 4-(Trifluoromethyl)-3-pyridineacetonitrile is a valuable compound in synthetic chemistry, with applications in medicinal chemistry and material science.
Formula:C8H5F3N2
InChI:InChI=1S/C8H5F3N2/c9-8(10,11)7-2-4-13-5-6(7)1-3-12/h2,4-5H,1H2
InChI key:InChIKey=DWVZDCREWZARJT-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C(CC#N)=CN=CC1
Synonyms:
  • 4-(Trifluoromethyl)-3-pyridineacetonitrile
  • 3-Pyridineacetonitrile, 4-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.