
CAS 1227515-23-2
:4-Iodo-3-methoxy-2-methylpyridine
Description:
4-Iodo-3-methoxy-2-methylpyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of the iodine atom at the 4-position and a methoxy group at the 3-position, along with a methyl group at the 2-position, contributes to its unique chemical properties. This compound is typically a pale yellow to brown solid and is soluble in organic solvents. Its molecular structure suggests potential reactivity due to the electron-withdrawing nature of the iodine atom and the electron-donating properties of the methoxy group, which can influence its behavior in chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Safety data should be consulted for handling, as halogenated compounds can pose health risks.
Formula:C7H8INO
InChI:InChI=1S/C7H8INO/c1-5-7(10-2)6(8)3-4-9-5/h3-4H,1-2H3
InChI key:InChIKey=GRXJRWLTZRYALV-UHFFFAOYSA-N
SMILES:O(C)C=1C(I)=CC=NC1C
Synonyms:- 4-Iodo-3-methoxy-2-methylpyridine
- Pyridine, 4-iodo-3-methoxy-2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.