CAS 1227515-77-6

2-Amino-6-(trifluoromethyl)-4-pyridineacetic acid

Description:

2-Amino-6-(trifluoromethyl)-4-pyridineacetic acid is an organic compound characterized by its pyridine ring structure, which is substituted with an amino group and a trifluoromethyl group. The presence of the amino group (-NH2) indicates that it can act as a base, while the trifluoromethyl group (-CF3) is known for its electron-withdrawing properties, influencing the compound's reactivity and polarity. This compound is likely to exhibit both acidic and basic characteristics due to the carboxylic acid functional group (-COOH) associated with the pyridineacetic acid structure. Its trifluoromethyl substitution can enhance lipophilicity and may affect its biological activity, making it of interest in pharmaceutical research. The compound's solubility, stability, and interaction with biological systems can vary significantly based on its molecular structure and substituents. Overall, 2-Amino-6-(trifluoromethyl)-4-pyridineacetic acid is a versatile compound with potential applications in medicinal chemistry and agrochemicals.

Formula: C₈H₇F₃N₂O₂

InChI: InChI=1S/C8H7F3N2O2/c9-8(10,11)5-1-4(3-7(14)15)2-6(12)13-5/h1-2H,3H2,(H2,12,13)(H,14,15)

InChI key: InChIKey=XDPDLIDGLNLBJM-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=CC(CC(O)=O)=CC(N)=N1

Synonyms:

• 4-Pyridineacetic acid, 2-amino-6-(trifluoromethyl)-
• 2-Amino-6-(trifluoromethyl)-4-pyridineacetic acid