CAS 1227516-19-9

5-Phenyl-3-pyridineacetic acid

Description:

5-Phenyl-3-pyridineacetic acid is an organic compound characterized by its unique structure, which includes a pyridine ring and a phenyl group attached to an acetic acid moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for various chemical reactions. It is likely to be a solid at room temperature, with moderate solubility in polar solvents due to the presence of the carboxylic acid functional group. The compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting neurological or inflammatory conditions. Its molecular structure allows for potential interactions with biological receptors, which could lead to various pharmacological effects. Additionally, the presence of both the phenyl and pyridine groups may contribute to its lipophilicity and ability to cross biological membranes. As with many organic compounds, safety data and handling precautions should be considered when working with this substance in a laboratory setting.

Formula: C₁₃H₁₁NO₂

InChI: InChI=1S/C13H11NO2/c15-13(16)7-10-6-12(9-14-8-10)11-4-2-1-3-5-11/h1-6,8-9H,7H2,(H,15,16)

InChI key: InChIKey=GVNUFSDPKCWLNY-UHFFFAOYSA-N

SMILES: C(C(O)=O)C1=CC(=CN=C1)C2=CC=CC=C2

Synonyms:

• 5-Phenyl-3-pyridineacetic acid
• 3-Pyridineacetic acid, 5-phenyl-