CAS 122752-15-2: tyr-D-ala-phe-asp-val-val-gly amide
Description:Tyr-D-Ala-Phe-Asp-Val-Val-Gly amide, with the CAS number 122752-15-2, is a synthetic peptide that exhibits characteristics typical of peptide compounds. It consists of a sequence of amino acids, including tyrosine (Tyr), D-alanine (D-Ala), phenylalanine (Phe), aspartic acid (Asp), valine (Val), and glycine (Gly), with an amide functional group at the terminal end. This structure contributes to its potential biological activity, which may include interactions with specific receptors or enzymes in biological systems. Peptides like this one are often studied for their roles in pharmacology, biochemistry, and molecular biology, particularly in the context of drug design and therapeutic applications. The presence of D-amino acids, such as D-Ala, can enhance stability against enzymatic degradation, making such peptides more viable for therapeutic use. Additionally, the hydrophobic and polar characteristics of the amino acids in the sequence can influence the peptide's solubility, folding, and overall biological function.
Formula:C37H52N8O10
InChI:InChI=1/C37H52N8O10/c1-19(2)30(36(54)40-18-28(39)47)45-37(55)31(20(3)4)44-35(53)27(17-29(48)49)43-34(52)26(16-22-9-7-6-8-10-22)42-32(50)21(5)41-33(51)25(38)15-23-11-13-24(46)14-12-23/h6-14,19-21,25-27,30-31,46H,15-18,38H2,1-5H3,(H2,39,47)(H,40,54)(H,41,51)(H,42,50)(H,43,52)(H,44,53)(H,45,55)(H,48,49)/t21-,25+,26+,27+,30+,31?/m1/s1
- Synonyms:
- H-Tyr-D-Ala-Phe-Asp-Val-Val-Gly-NH2
- Deltorphin I
- L-tyrosyl-D-alanyl-L-phenylalanyl-L-alpha-aspartylvalyl-L-valylglycinamide