CymitQuimica logo

CAS 1227563-01-0

:

2-(3-Fluorophenyl)-3-pyridineacetonitrile

Description:
2-(3-Fluorophenyl)-3-pyridineacetonitrile is an organic compound characterized by its unique structure, which includes a pyridine ring and a fluorophenyl group. The presence of the nitrile functional group (-C≡N) contributes to its reactivity and polarity, making it a potential candidate for various chemical reactions and applications in medicinal chemistry. The fluorine atom in the 3-position of the phenyl ring can influence the compound's electronic properties, potentially enhancing its biological activity or altering its interaction with biological targets. This compound may exhibit characteristics such as moderate solubility in organic solvents and stability under standard laboratory conditions. Its molecular structure suggests potential applications in drug development, particularly in the synthesis of pharmaceuticals targeting specific biological pathways. Additionally, the presence of both aromatic and heterocyclic components may provide interesting properties related to lipophilicity and binding affinity. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C13H9FN2
InChI:InChI=1S/C13H9FN2/c14-12-5-1-3-11(9-12)13-10(6-7-15)4-2-8-16-13/h1-5,8-9H,6H2
InChI key:InChIKey=RSVZYCUCUNHVBD-UHFFFAOYSA-N
SMILES:C(C#N)C1=C(N=CC=C1)C2=CC(F)=CC=C2
Synonyms:
  • 3-Pyridineacetonitrile, 2-(3-fluorophenyl)-
  • 2-(3-Fluorophenyl)-3-pyridineacetonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.