
CAS 1227563-23-6
:6-(Bromomethyl)-5-chloro-2(1H)-pyridinone
Description:
6-(Bromomethyl)-5-chloro-2(1H)-pyridinone is a heterocyclic organic compound characterized by its pyridinone structure, which features a pyridine ring with a carbonyl group and various substituents. The presence of a bromomethyl group and a chlorine atom contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its molecular structure suggests it could participate in nucleophilic substitution reactions due to the electrophilic nature of the bromomethyl group. Additionally, the chlorine atom may influence the compound's electronic properties and stability. The compound's unique characteristics make it of interest for research in developing pharmaceuticals or agrochemicals, where halogenated compounds often play a crucial role in enhancing biological activity. Safety and handling precautions should be observed, as halogenated compounds can pose health risks and environmental concerns.
Formula:C6H5BrClNO
InChI:InChI=1S/C6H5BrClNO/c7-3-5-4(8)1-2-6(10)9-5/h1-2H,3H2,(H,9,10)
InChI key:InChIKey=PZXAYDGHJWPGPG-UHFFFAOYSA-N
SMILES:C(Br)C1=C(Cl)C=CC(=O)N1
Synonyms:- 2(1H)-Pyridinone, 6-(bromomethyl)-5-chloro-
- 6-(Bromomethyl)-5-chloro-2(1H)-pyridinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.