
CAS 1227563-53-2
:7-Fluoro-4-methoxy-1H-indole-3-carboxaldehyde
Description:
7-Fluoro-4-methoxy-1H-indole-3-carboxaldehyde is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a fluorine atom at the 7-position and a methoxy group at the 4-position contributes to its unique reactivity and potential biological activity. The aldehyde functional group at the 3-position makes it a versatile intermediate in organic synthesis, allowing for further derivatization. This compound may exhibit interesting properties such as fluorescence, which can be useful in various applications, including medicinal chemistry and materials science. Its structural features suggest potential interactions with biological targets, making it a candidate for research in pharmacology. Additionally, the compound's solubility and stability can be influenced by the substituents on the indole ring, which are critical for its application in drug development and other chemical processes. Overall, 7-Fluoro-4-methoxy-1H-indole-3-carboxaldehyde represents a valuable compound in the field of organic and medicinal chemistry.
Formula:C10H8FNO2
InChI:InChI=1S/C10H8FNO2/c1-14-8-3-2-7(11)10-9(8)6(5-13)4-12-10/h2-5,12H,1H3
InChI key:InChIKey=PJMXDSOJKVYVEF-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(=C(F)C=C1)NC=C2C=O
Synonyms:- 1H-Indole-3-carboxaldehyde, 7-fluoro-4-methoxy-
- 7-Fluoro-4-methoxy-1H-indole-3-carboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.