
CAS 1227563-69-0
:2-Fluoro-6-methoxy-4-pyridinecarboxaldehyde
Description:
2-Fluoro-6-methoxy-4-pyridinecarboxaldehyde is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing nitrogen. The presence of a fluorine atom at the 2-position and a methoxy group at the 6-position contributes to its unique reactivity and properties. The aldehyde functional group at the 4-position makes it a versatile intermediate in organic synthesis, allowing for various chemical transformations. This compound is typically a pale yellow to light brown liquid or solid, depending on its purity and form. It is soluble in organic solvents, which enhances its utility in chemical reactions. The presence of the methoxy group can influence its electronic properties, potentially affecting its reactivity and interactions with other molecules. Additionally, the fluorine atom can impart unique characteristics such as increased lipophilicity and altered hydrogen bonding capabilities. Overall, 2-Fluoro-6-methoxy-4-pyridinecarboxaldehyde is of interest in medicinal chemistry and material science for its potential applications in drug development and as a building block in synthetic chemistry.
Formula:C7H6FNO2
InChI:InChI=1S/C7H6FNO2/c1-11-7-3-5(4-10)2-6(8)9-7/h2-4H,1H3
InChI key:InChIKey=QMUHOBITZXTREX-UHFFFAOYSA-N
SMILES:C(=O)C=1C=C(OC)N=C(F)C1
Synonyms:- 2-Fluoro-6-methoxy-4-pyridinecarboxaldehyde
- 4-Pyridinecarboxaldehyde, 2-fluoro-6-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.