
CAS 1227564-01-3
:Methyl 2-fluoro-6-(trifluoromethyl)-3-pyridinecarboxylate
Description:
Methyl 2-fluoro-6-(trifluoromethyl)-3-pyridinecarboxylate is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a methyl ester functional group, contributing to its reactivity and solubility in organic solvents. The presence of a fluorine atom at the 2-position and a trifluoromethyl group at the 6-position of the pyridine ring significantly influences its electronic properties, making it a potential candidate for various applications in pharmaceuticals and agrochemicals. The trifluoromethyl group is known for imparting lipophilicity and enhancing biological activity, while the fluorine atom can affect the compound's stability and reactivity. Methyl 2-fluoro-6-(trifluoromethyl)-3-pyridinecarboxylate may exhibit interesting chemical behavior, including potential nucleophilic substitution reactions, due to the electron-withdrawing nature of the fluorine and trifluoromethyl groups. Overall, this compound's unique structural features make it a subject of interest in synthetic organic chemistry and medicinal chemistry research.
Formula:C8H5F4NO2
InChI:InChI=1S/C8H5F4NO2/c1-15-7(14)4-2-3-5(8(10,11)12)13-6(4)9/h2-3H,1H3
InChI key:InChIKey=SOULLKAIHWLQIH-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(F)N=C(C(F)(F)F)C=C1
Synonyms:- Methyl 2-fluoro-6-(trifluoromethyl)-3-pyridinecarboxylate
- 3-Pyridinecarboxylic acid, 2-fluoro-6-(trifluoromethyl)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.