CAS 122757-54-4
:3'-deoxy-2',3'-didehydro-2'fluorothymidine
Description:
3'-Deoxy-2',3'-didehydro-2'-fluorothymidine, commonly known as FDT, is a synthetic nucleoside analog of thymidine. It is characterized by the absence of the 3'-hydroxyl group and the presence of a fluorine atom at the 2' position, along with a double bond between the 2' and 3' carbons. This structural modification enhances its stability and resistance to enzymatic degradation, making it a potential candidate for antiviral and anticancer therapies. FDT exhibits antiviral activity, particularly against certain strains of HIV, by inhibiting reverse transcriptase, an essential enzyme for viral replication. Its mechanism of action involves incorporation into viral DNA, leading to chain termination. Additionally, FDT's unique chemical properties allow for improved pharmacokinetics compared to its natural counterparts. The compound is typically studied in the context of medicinal chemistry and drug development, with ongoing research aimed at optimizing its efficacy and reducing potential side effects. Overall, FDT represents a significant advancement in the field of antiviral agents and nucleoside analogs.
Formula:C10H11FN2O4
InChI:InChI=1/C10H11FN2O4/c1-5-3-13(10(16)12-8(5)15)9-7(11)2-6(4-14)17-9/h2-3,6,9,14H,4H2,1H3,(H,12,15,16)/t6-,9+/m0/s1
Synonyms:- 3-Ddft
- Uridine, 2',3'-didehydro-2',3'-dideoxy-2'-fluoro-5-methyl-
- 1-[(2R,5S)-3-fluoro-5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]-5-methylpyrimidine-2,4(1H,3H)-dione
- 3'-Deoxy-2',3'-didehydro-2'-fluorothymidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Uridine, 2',3'-didehydro-2',3'-dideoxy-2'-fluoro-5-methyl-
CAS:Formula:C10H11FN2O4Molecular weight:242.20373'-Deoxy-2',3'-Didehydro-2'Fluorothymidine
CAS:3'-Deoxy-2',3'-Didehydro-2'Fluorothymidine (3DFT) is a nucleoside analogue of thymidine. It has been shown to be an efficient inhibitor of HIV replication in vitro and in vivo. 3DFT is able to inhibit virus production by blocking the viral reverse transcriptase enzyme, which is responsible for copying the viral genomic RNA into DNA. This drug also inhibits the activity of human immunodeficiency virus type 1 integrase, which is an enzyme that catalyses the integration of proviral DNA into host cell chromosomes. 3DFT is a potent inhibitor of HIV infection in vitro and in vivo and has also been shown to inhibit other viruses such as cytomegalovirus, herpes simplex virus types 1 and 2, varicella zoster virus, influenza A virus, coxsackie B4 virus, echovirus 7, and erythrovirus 9.Formula:C10H11FN2O4Purity:Min. 95%Molecular weight:242.2 g/mol

