
CAS 1227570-81-1
:4-(Chloromethyl)-2-methoxy-5-(trifluoromethyl)pyridine
Description:
4-(Chloromethyl)-2-methoxy-5-(trifluoromethyl)pyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a chloromethyl group (-CH2Cl) and a methoxy group (-OCH3) at the 4 and 2 positions, respectively, along with a trifluoromethyl group (-CF3) at the 5 position. The presence of the trifluoromethyl group imparts unique electronic properties, enhancing the compound's lipophilicity and potentially influencing its reactivity and biological activity. The chloromethyl group can serve as a reactive site for further chemical modifications, making this compound valuable in synthetic chemistry and medicinal chemistry applications. Additionally, the methoxy group can affect the compound's solubility and stability. Overall, this compound's structural features suggest potential utility in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis.
Formula:C8H7ClF3NO
InChI:InChI=1S/C8H7ClF3NO/c1-14-7-2-5(3-9)6(4-13-7)8(10,11)12/h2,4H,3H2,1H3
InChI key:InChIKey=NCRBXVVNHPKJML-UHFFFAOYSA-N
SMILES:C(Cl)C=1C(C(F)(F)F)=CN=C(OC)C1
Synonyms:- Pyridine, 4-(chloromethyl)-2-methoxy-5-(trifluoromethyl)-
- 4-(Chloromethyl)-2-methoxy-5-(trifluoromethyl)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.