CAS 1227570-93-5

2,5-Dibromo-3-pyridineacetonitrile

Description:

2,5-Dibromo-3-pyridineacetonitrile is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features two bromine substituents at the 2 and 5 positions of the pyridine ring, contributing to its reactivity and potential applications in various chemical reactions. The presence of the acetonitrile functional group at the 3-position enhances its polarity and solubility in polar solvents. Typically, compounds like 2,5-Dibromo-3-pyridineacetonitrile are of interest in medicinal chemistry and material science due to their ability to participate in nucleophilic substitutions and coupling reactions. The bromine atoms can serve as leaving groups or sites for further functionalization, making this compound a versatile intermediate in synthetic pathways. Additionally, its unique structure may impart specific biological activities, warranting investigation in pharmaceutical research. As with many halogenated compounds, safety precautions should be observed due to potential toxicity and environmental impact.

Formula: C₇H₄Br₂N₂

InChI: InChI=1S/C7H4Br2N2/c8-6-3-5(1-2-10)7(9)11-4-6/h3-4H,1H2

InChI key: InChIKey=RZYADCZZBPJTQX-UHFFFAOYSA-N

SMILES: C(C#N)C1=C(Br)N=CC(Br)=C1

Synonyms:

• 2,5-Dibromo-3-pyridineacetonitrile
• 3-Pyridineacetonitrile, 2,5-dibromo-