
CAS 1227570-94-6
:3-Fluoro-5-(3-fluorophenyl)-4-pyridinemethanol
Description:
3-Fluoro-5-(3-fluorophenyl)-4-pyridinemethanol is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with both fluorine atoms and a phenyl group. The presence of the hydroxymethyl group (-CH2OH) at the 4-position of the pyridine ring contributes to its potential as a versatile building block in organic synthesis and medicinal chemistry. The fluorine substituents enhance the compound's lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. This compound is likely to exhibit polar characteristics due to the hydroxyl group, which can participate in hydrogen bonding. Its molecular interactions and reactivity can be further explored in various chemical environments, potentially leading to applications in drug development or as an intermediate in the synthesis of more complex molecules. As with many fluorinated compounds, it may also exhibit unique properties such as increased metabolic stability and altered pharmacokinetics. Safety and handling precautions should be observed due to the presence of fluorine and the potential for biological activity.
Formula:C12H9F2NO
InChI:InChI=1S/C12H9F2NO/c13-9-3-1-2-8(4-9)10-5-15-6-12(14)11(10)7-16/h1-6,16H,7H2
InChI key:InChIKey=HLSGQIIINKCIQJ-UHFFFAOYSA-N
SMILES:C(O)C=1C(=CN=CC1F)C2=CC(F)=CC=C2
Synonyms:- 3-Fluoro-5-(3-fluorophenyl)-4-pyridinemethanol
- 4-Pyridinemethanol, 3-fluoro-5-(3-fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.