
CAS 1227571-03-0
:2,6-Dichloro-4-pyridineacetonitrile
Description:
2,6-Dichloro-4-pyridineacetonitrile is a chemical compound characterized by its pyridine ring structure, which is substituted with two chlorine atoms at the 2 and 6 positions and a cyano group at the 4 position. This compound typically appears as a solid or crystalline substance and is known for its potential applications in pharmaceuticals and agrochemicals due to its biological activity. The presence of the cyano group contributes to its reactivity, making it a useful intermediate in organic synthesis. It is generally soluble in polar organic solvents, and its properties can be influenced by the presence of the chlorine substituents, which can affect its electronic characteristics and reactivity. Safety data should be consulted, as halogenated compounds can exhibit toxicity and environmental persistence. Proper handling and disposal procedures are essential when working with this substance in a laboratory setting.
Formula:C7H4Cl2N2
InChI:InChI=1S/C7H4Cl2N2/c8-6-3-5(1-2-10)4-7(9)11-6/h3-4H,1H2
InChI key:InChIKey=APHGXQVICQALTB-UHFFFAOYSA-N
SMILES:C(C#N)C=1C=C(Cl)N=C(Cl)C1
Synonyms:- 2,6-Dichloro-4-pyridineacetonitrile
- 4-Pyridineacetonitrile, 2,6-dichloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.