
CAS 1227571-85-8
:5-Chloro-7-fluoro-1H-indole-3-acetonitrile
Description:
5-Chloro-7-fluoro-1H-indole-3-acetonitrile is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of chlorine and fluorine substituents at the 5 and 7 positions, respectively, contributes to its unique reactivity and potential biological activity. The acetonitrile functional group at the 3-position enhances its polar character, making it soluble in various organic solvents. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its molecular structure suggests potential interactions with biological targets, which could be explored in research settings. Additionally, the presence of halogens often influences the compound's stability, lipophilicity, and overall chemical behavior. As with many indole derivatives, it may also participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, which are important in synthetic organic chemistry. Safety and handling precautions should be observed due to the presence of halogenated groups, which can pose health risks.
Formula:C10H6ClFN2
InChI:InChI=1S/C10H6ClFN2/c11-7-3-8-6(1-2-13)5-14-10(8)9(12)4-7/h3-5,14H,1H2
InChI key:InChIKey=BVLCEJSAHZFHSI-UHFFFAOYSA-N
SMILES:C(C#N)C=1C=2C(=C(F)C=C(Cl)C2)NC1
Synonyms:- 1H-Indole-3-acetonitrile, 5-chloro-7-fluoro-
- 5-Chloro-7-fluoro-1H-indole-3-acetonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.