
CAS 1227573-15-0
:3-Bromo-1,2-dihydro-2-oxo-4-pyridinecarboxaldehyde
Description:
3-Bromo-1,2-dihydro-2-oxo-4-pyridinecarboxaldehyde is a heterocyclic organic compound characterized by its pyridine ring structure, which is substituted with a bromine atom and an aldehyde functional group. This compound features a dihydro-2-oxo moiety, indicating the presence of a carbonyl group adjacent to the pyridine ring. The bromine substitution can influence the compound's reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The aldehyde group contributes to its reactivity, allowing it to participate in condensation reactions and serve as a precursor for further synthetic transformations. Additionally, the presence of the pyridine ring may impart specific biological activities, making it of interest in medicinal chemistry. The compound's solubility, stability, and reactivity can vary depending on the solvent and conditions used, which are important considerations for its application in research and industry. Overall, 3-Bromo-1,2-dihydro-2-oxo-4-pyridinecarboxaldehyde is a versatile compound with potential applications in organic synthesis and pharmaceuticals.
Formula:C6H4BrNO2
InChI:InChI=1S/C6H4BrNO2/c7-5-4(3-9)1-2-8-6(5)10/h1-3H,(H,8,10)
InChI key:InChIKey=PJCUXZIGQIKIHS-UHFFFAOYSA-N
SMILES:C(=O)C1=C(Br)C(=O)NC=C1
Synonyms:- 3-Bromo-1,2-dihydro-2-oxo-4-pyridinecarboxaldehyde
- 4-Pyridinecarboxaldehyde, 3-bromo-1,2-dihydro-2-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.