
CAS 1227573-65-0
:5-Chloro-6-(chloromethyl)-2(1H)-pyridinone
Description:
5-Chloro-6-(chloromethyl)-2(1H)-pyridinone is a heterocyclic organic compound characterized by a pyridinone structure, which features a pyridine ring with a ketone and chlorine substituents. This compound typically exhibits a pale yellow to light brown appearance and is soluble in polar organic solvents. The presence of chlorine atoms contributes to its reactivity, making it a potential intermediate in various chemical syntheses, particularly in pharmaceuticals and agrochemicals. Its molecular structure suggests it may participate in nucleophilic substitution reactions due to the electrophilic nature of the chloromethyl group. Additionally, the compound may exhibit biological activity, which can be explored for potential applications in medicinal chemistry. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, 5-Chloro-6-(chloromethyl)-2(1H)-pyridinone is a versatile compound with significant implications in synthetic organic chemistry.
Formula:C6H5Cl2NO
InChI:InChI=1S/C6H5Cl2NO/c7-3-5-4(8)1-2-6(10)9-5/h1-2H,3H2,(H,9,10)
InChI key:InChIKey=QQMNQCQJVLXFNS-UHFFFAOYSA-N
SMILES:C(Cl)C1=C(Cl)C=CC(=O)N1
Synonyms:- 2(1H)-Pyridinone, 5-chloro-6-(chloromethyl)-
- 5-Chloro-6-(chloromethyl)-2(1H)-pyridinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.