CymitQuimica logo

CAS 1227574-11-9

:

3-(Bromomethyl)-2,5-difluoropyridine

Description:
3-(Bromomethyl)-2,5-difluoropyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with bromomethyl and difluoro groups. The presence of the bromomethyl group introduces a reactive site, making it useful in various chemical reactions, particularly in nucleophilic substitution and coupling reactions. The difluoro substituents enhance the compound's lipophilicity and can influence its electronic properties, potentially affecting its reactivity and interactions with biological targets. This compound is typically used in pharmaceutical research and development, particularly in the synthesis of biologically active molecules. Its molecular structure contributes to its stability and solubility in organic solvents, while the halogen substituents can also impart unique properties such as increased metabolic stability. Safety data should be consulted, as halogenated compounds can exhibit varying degrees of toxicity and environmental impact. Overall, 3-(Bromomethyl)-2,5-difluoropyridine is a valuable intermediate in organic synthesis and medicinal chemistry.
Formula:C6H4BrF2N
InChI:InChI=1S/C6H4BrF2N/c7-2-4-1-5(8)3-10-6(4)9/h1,3H,2H2
InChI key:InChIKey=CHWVVMRUIKMCEG-UHFFFAOYSA-N
SMILES:C(Br)C1=C(F)N=CC(F)=C1
Synonyms:
  • Pyridine, 3-(bromomethyl)-2,5-difluoro-
  • 3-(Bromomethyl)-2,5-difluoropyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.