CAS 1227574-47-1

2,3-Dichloro-6-(chloromethyl)pyridine

Description:

2,3-Dichloro-6-(chloromethyl)pyridine is a chlorinated pyridine derivative characterized by the presence of two chlorine atoms at the 2 and 3 positions and a chloromethyl group at the 6 position of the pyridine ring. This compound typically appears as a colorless to yellow liquid or solid, depending on its physical state at room temperature. It is known for its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its reactivity and ability to participate in various chemical reactions. The presence of multiple chlorine substituents enhances its electrophilic character, making it a useful intermediate in further chemical transformations. Additionally, it may exhibit biological activity, which warrants careful handling and consideration of safety protocols, as chlorinated compounds can pose environmental and health risks. As with many halogenated compounds, it is important to assess its stability, solubility, and reactivity under different conditions to fully understand its behavior in chemical processes.

Formula: C₆H₄Cl₃N

InChI: InChI=1S/C6H4Cl3N/c7-3-4-1-2-5(8)6(9)10-4/h1-2H,3H2

InChI key: InChIKey=IHOWWWKBTARALY-UHFFFAOYSA-N

SMILES: C(Cl)C=1N=C(Cl)C(Cl)=CC1

Synonyms:

• 2,3-Dichloro-6-(chloromethyl)pyridine
• Pyridine, 2,3-dichloro-6-(chloromethyl)-