CAS 1227574-73-3

Methyl 2-amino-4-(trifluoromethyl)-3-pyridinecarboxylate

Description:

Methyl 2-amino-4-(trifluoromethyl)-3-pyridinecarboxylate is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a methyl ester functional group, contributing to its reactivity and solubility in organic solvents. The presence of the trifluoromethyl group (-CF3) significantly influences its electronic properties, enhancing lipophilicity and potentially affecting its biological activity. The amino group (-NH2) introduces basicity and can participate in hydrogen bonding, making the compound versatile in various chemical reactions. This substance is typically used in pharmaceutical research and development due to its potential applications in drug synthesis and as an intermediate in organic synthesis. Its unique combination of functional groups allows for diverse reactivity, making it a valuable compound in medicinal chemistry. Safety data should be consulted for handling, as the trifluoromethyl group can impart specific hazards associated with fluorinated compounds.

Formula: C₈H₇F₃N₂O₂

InChI: InChI=1S/C8H7F3N2O2/c1-15-7(14)5-4(8(9,10)11)2-3-13-6(5)12/h2-3H,1H3,(H2,12,13)

InChI key: InChIKey=PPLQOVNUYBRXHU-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C(C(F)(F)F)=CC=NC1N

Synonyms:

• Methyl 2-amino-4-(trifluoromethyl)-3-pyridinecarboxylate
• 3-Pyridinecarboxylic acid, 2-amino-4-(trifluoromethyl)-, methyl ester