
CAS 1227574-93-7
:Methyl 3-amino-2-(trifluoromethyl)-4-pyridinecarboxylate
Description:
Methyl 3-amino-2-(trifluoromethyl)-4-pyridinecarboxylate is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of the amino group (-NH2) at the 3-position and a trifluoromethyl group (-CF3) at the 2-position significantly influences its chemical properties, including its reactivity and polarity. The methyl ester functional group at the 4-position contributes to its solubility in organic solvents and its potential for further chemical modifications. This compound is of interest in medicinal chemistry and agrochemicals due to its potential biological activity and ability to act as a building block for more complex molecules. Its trifluoromethyl group can enhance lipophilicity and metabolic stability, making it a valuable moiety in drug design. Additionally, the compound's unique structure may impart specific interactions with biological targets, making it a candidate for further research in pharmacology and related fields.
Formula:C8H7F3N2O2
InChI:InChI=1S/C8H7F3N2O2/c1-15-7(14)4-2-3-13-6(5(4)12)8(9,10)11/h2-3H,12H2,1H3
InChI key:InChIKey=NGIWWNMZYOQEMD-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(N)C(C(OC)=O)=CC=N1
Synonyms:- Methyl 3-amino-2-(trifluoromethyl)-4-pyridinecarboxylate
- 4-Pyridinecarboxylic acid, 3-amino-2-(trifluoromethyl)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.