CymitQuimica logo

CAS 1227574-94-8

:

2,4-Dimethoxy-5-methylpyridine

Description:
2,4-Dimethoxy-5-methylpyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of two methoxy groups (-OCH3) at the 2 and 4 positions and a methyl group (-CH3) at the 5 position contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its state at room temperature. It is soluble in organic solvents, reflecting its non-polar characteristics, while its nitrogen atom can engage in hydrogen bonding, influencing its reactivity and interactions. 2,4-Dimethoxy-5-methylpyridine may exhibit biological activity, making it of interest in medicinal chemistry and research. Its structure allows for potential applications in the synthesis of other chemical compounds or as a ligand in coordination chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H11NO2
InChI:InChI=1S/C8H11NO2/c1-6-5-9-8(11-3)4-7(6)10-2/h4-5H,1-3H3
InChI key:InChIKey=BICURXLPGZOSEE-UHFFFAOYSA-N
SMILES:O(C)C=1C=C(OC)N=CC1C
Synonyms:
  • 2,4-Dimethoxy-5-methylpyridine
  • Pyridine, 2,4-dimethoxy-5-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.