
CAS 1227574-95-9
:4-(Chloromethyl)-3-(trifluoromethyl)pyridine
Description:
4-(Chloromethyl)-3-(trifluoromethyl)pyridine, identified by its CAS number 1227574-95-9, is a heterocyclic organic compound featuring a pyridine ring substituted with both a chloromethyl group and a trifluoromethyl group. The presence of the chloromethyl group introduces a reactive site, making it useful in various chemical reactions, including nucleophilic substitutions. The trifluoromethyl group significantly enhances the compound's lipophilicity and can influence its electronic properties, often leading to increased stability and reactivity in certain contexts. This compound is typically characterized by its distinct molecular structure, which contributes to its potential applications in pharmaceuticals, agrochemicals, and materials science. Its physical properties, such as boiling point, melting point, and solubility, can vary based on the specific conditions and purity of the sample. Overall, 4-(Chloromethyl)-3-(trifluoromethyl)pyridine is of interest in synthetic chemistry due to its unique functional groups and the reactivity they confer.
Formula:C7H5ClF3N
InChI:InChI=1S/C7H5ClF3N/c8-3-5-1-2-12-4-6(5)7(9,10)11/h1-2,4H,3H2
InChI key:InChIKey=DEJPAWIQXGNIPJ-UHFFFAOYSA-N
SMILES:C(Cl)C=1C(C(F)(F)F)=CN=CC1
Synonyms:- 4-(Chloromethyl)-3-(trifluoromethyl)pyridine
- Pyridine, 4-(chloromethyl)-3-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.