CymitQuimica logo

CAS 1227575-02-1

:

3-Fluoro-2,4-dimethylpyridine

Description:
3-Fluoro-2,4-dimethylpyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with two methyl groups at the 2 and 4 positions and a fluorine atom at the 3 position. This compound belongs to the class of fluorinated pyridines, which are known for their diverse applications in pharmaceuticals, agrochemicals, and materials science. The presence of the fluorine atom can enhance the compound's lipophilicity and metabolic stability, making it of interest in drug design. The methyl groups contribute to the compound's steric properties and can influence its reactivity and interaction with biological targets. Typically, such compounds exhibit moderate polarity and can participate in hydrogen bonding due to the nitrogen atom in the pyridine ring. The physical properties, such as boiling point and solubility, can vary based on the specific molecular structure and substituents. Overall, 3-Fluoro-2,4-dimethylpyridine is a valuable compound in synthetic chemistry and medicinal applications, with potential for further exploration in various chemical contexts.
Formula:C7H8FN
InChI:InChI=1S/C7H8FN/c1-5-3-4-9-6(2)7(5)8/h3-4H,1-2H3
InChI key:InChIKey=ANSKFBDJVMXKBH-UHFFFAOYSA-N
SMILES:FC=1C(C)=CC=NC1C
Synonyms:
  • 3-Fluoro-2,4-dimethylpyridine
  • Pyridine, 3-fluoro-2,4-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.