CymitQuimica logo

CAS 1227575-77-0

:

1,2-Dihydro-4-methyl-2-oxo-3-pyridinecarboxaldehyde

Description:
1,2-Dihydro-4-methyl-2-oxo-3-pyridinecarboxaldehyde is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a dihydro form, indicating the presence of two hydrogen atoms that contribute to its saturation. The presence of a methyl group and a carboxaldehyde functional group enhances its reactivity and solubility in various organic solvents. The ketone functionality (2-oxo) suggests that it can participate in nucleophilic addition reactions, while the aldehyde group can undergo oxidation or condensation reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for potential interactions with biological targets, which could lead to various pharmacological effects. As with many organic compounds, its stability, reactivity, and potential applications can be influenced by environmental factors such as pH and temperature. Overall, 1,2-Dihydro-4-methyl-2-oxo-3-pyridinecarboxaldehyde represents a versatile structure in organic synthesis and medicinal chemistry.
Formula:C7H7NO2
InChI:InChI=1S/C7H7NO2/c1-5-2-3-8-7(10)6(5)4-9/h2-4H,1H3,(H,8,10)
InChI key:InChIKey=PZFVLLNNCXGQRE-UHFFFAOYSA-N
SMILES:C(=O)C1=C(C)C=CNC1=O
Synonyms:
  • 3-Pyridinecarboxaldehyde, 1,2-dihydro-4-methyl-2-oxo-
  • 1,2-Dihydro-4-methyl-2-oxo-3-pyridinecarboxaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.