CAS 1227575-89-4

Methyl 6-methoxy-2-(trifluoromethyl)-3-pyridinecarboxylate

Description:

Methyl 6-methoxy-2-(trifluoromethyl)-3-pyridinecarboxylate is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a methoxy group (-OCH3) at the 6-position and a trifluoromethyl group (-CF3) at the 2-position significantly influences its chemical properties, including its reactivity and polarity. This compound is typically a colorless to pale yellow liquid or solid, depending on its state at room temperature. It is soluble in organic solvents, which is common for many pyridine derivatives. The trifluoromethyl group enhances the compound's lipophilicity and can affect its biological activity, making it of interest in medicinal chemistry. Additionally, the methyl ester functional group contributes to its reactivity, allowing for potential hydrolysis or transesterification reactions. Overall, this compound's unique structure and functional groups make it a valuable candidate for various applications in pharmaceuticals and agrochemicals.

Formula: C₉H₈F₃NO₃

InChI: InChI=1S/C9H8F3NO3/c1-15-6-4-3-5(8(14)16-2)7(13-6)9(10,11)12/h3-4H,1-2H3

InChI key: InChIKey=NBHRVFQBRHWCCK-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C(C(F)(F)F)N=C(OC)C=C1

Synonyms:

• Methyl 6-methoxy-2-(trifluoromethyl)-3-pyridinecarboxylate
• 3-Pyridinecarboxylic acid, 6-methoxy-2-(trifluoromethyl)-, methyl ester