CAS 1227576-28-4

Ethyl 1,2-dihydro-2-oxo-5-(trifluoromethyl)-3-pyridinecarboxylate

Description:

Ethyl 1,2-dihydro-2-oxo-5-(trifluoromethyl)-3-pyridinecarboxylate is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a trifluoromethyl group, which significantly influences its chemical properties, including increased lipophilicity and potential biological activity. The presence of the ethyl ester group contributes to its solubility in organic solvents and may enhance its reactivity in various chemical reactions. The diketone functionality (1,2-dihydro-2-oxo) suggests that it may participate in nucleophilic addition reactions or serve as a precursor for further synthetic transformations. Additionally, the trifluoromethyl group can impart unique electronic properties, making this compound of interest in medicinal chemistry and material science. Overall, the combination of these functional groups makes Ethyl 1,2-dihydro-2-oxo-5-(trifluoromethyl)-3-pyridinecarboxylate a versatile compound with potential applications in drug development and organic synthesis.

Formula: C₉H₈F₃NO₃

InChI: InChI=1S/C9H8F3NO3/c1-2-16-8(15)6-3-5(9(10,11)12)4-13-7(6)14/h3-4H,2H2,1H3,(H,13,14)

InChI key: InChIKey=YGZGAFUJZTXGDC-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=CC(C(F)(F)F)=CNC1=O

Synonyms:

• Ethyl 1,2-dihydro-2-oxo-5-(trifluoromethyl)-3-pyridinecarboxylate
• 3-Pyridinecarboxylic acid, 1,2-dihydro-2-oxo-5-(trifluoromethyl)-, ethyl ester