
CAS 1227576-39-7
:4-Chloro-3-(trifluoromethyl)-2(1H)-pyridinone
Description:
4-Chloro-3-(trifluoromethyl)-2(1H)-pyridinone is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a chloro group at the 4-position and a trifluoromethyl group at the 3-position significantly influences its chemical properties, including its reactivity and polarity. This compound typically exhibits a pale yellow to light brown appearance and is soluble in polar organic solvents. It is known for its potential applications in pharmaceuticals and agrochemicals due to its ability to act as a building block in the synthesis of more complex molecules. The trifluoromethyl group enhances the lipophilicity and metabolic stability of the compound, making it an attractive candidate for drug development. Additionally, the presence of the nitrogen atom in the pyridine ring contributes to its basicity and potential interactions with biological targets. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks.
Formula:C6H3ClF3NO
InChI:InChI=1S/C6H3ClF3NO/c7-3-1-2-11-5(12)4(3)6(8,9)10/h1-2H,(H,11,12)
InChI key:InChIKey=UOJBNYWQMXIYOQ-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(Cl)C=CNC1=O
Synonyms:- 2(1H)-Pyridinone, 4-chloro-3-(trifluoromethyl)-
- 4-Chloro-3-(trifluoromethyl)-2(1H)-pyridinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.