CAS 1227578-89-3

2-Amino-5-bromo-4-pyridineacetic acid

Description:

2-Amino-5-bromo-4-pyridineacetic acid is an organic compound characterized by its pyridine ring structure, which is substituted with both an amino group and a bromo group, as well as a carboxylic acid functional group. This compound typically exhibits properties associated with both amino acids and heterocyclic compounds. The presence of the amino group contributes to its basicity, while the carboxylic acid group imparts acidic characteristics. The bromine substitution can influence the compound's reactivity and solubility in various solvents. It is likely to be soluble in polar solvents due to the presence of the carboxylic acid group, while the pyridine ring may enhance its interaction with biological systems. This compound may have potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with biological targets. Additionally, its unique combination of functional groups may allow for further chemical modifications, making it a versatile building block in organic synthesis.

Formula: C₇H₇BrN₂O₂

InChI: InChI=1S/C7H7BrN2O2/c8-5-3-10-6(9)1-4(5)2-7(11)12/h1,3H,2H2,(H2,9,10)(H,11,12)

InChI key: InChIKey=NTPLIAQCGDPKJK-UHFFFAOYSA-N

SMILES: C(C(O)=O)C=1C(Br)=CN=C(N)C1

Synonyms:

• 4-Pyridineacetic acid, 2-amino-5-bromo-
• 2-Amino-5-bromo-4-pyridineacetic acid