CAS 1227579-21-6

Ethyl 6-fluoro-2-(trifluoromethyl)-3-pyridinecarboxylate

Description:

Ethyl 6-fluoro-2-(trifluoromethyl)-3-pyridinecarboxylate is a chemical compound characterized by its pyridine ring structure, which is substituted at specific positions with a fluoro group and a trifluoromethyl group. This compound typically exhibits properties associated with both the pyridine moiety and the presence of fluorine atoms, such as increased lipophilicity and potential biological activity. The ethyl ester functional group contributes to its reactivity, making it a candidate for various chemical reactions, including esterification and nucleophilic substitutions. The presence of multiple fluorine atoms often enhances the compound's stability and alters its interaction with biological systems, potentially influencing its pharmacological properties. Additionally, the compound may exhibit unique spectral characteristics in techniques such as NMR and IR spectroscopy due to its specific functional groups and molecular structure. Overall, Ethyl 6-fluoro-2-(trifluoromethyl)-3-pyridinecarboxylate is of interest in medicinal chemistry and material science for its potential applications.

Formula: C₉H₇F₄NO₂

InChI: InChI=1S/C9H7F4NO2/c1-2-16-8(15)5-3-4-6(10)14-7(5)9(11,12)13/h3-4H,2H2,1H3

InChI key: InChIKey=NHLXRLQZFYQBTD-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=C(C(F)(F)F)N=C(F)C=C1

Synonyms:

• 3-Pyridinecarboxylic acid, 6-fluoro-2-(trifluoromethyl)-, ethyl ester
• Ethyl 6-fluoro-2-(trifluoromethyl)-3-pyridinecarboxylate