CymitQuimica logo

CAS 1227579-45-4

:

2-Bromo-4-methoxy-5-(trifluoromethyl)pyridine

Description:
2-Bromo-4-methoxy-5-(trifluoromethyl)pyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a bromine atom at the 2-position, a methoxy group (-OCH3) at the 4-position, and a trifluoromethyl group (-CF3) at the 5-position contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It exhibits moderate polarity due to the electronegative substituents, which can influence its solubility in various solvents. The trifluoromethyl group enhances its lipophilicity and can affect its reactivity, making it a valuable intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the presence of the bromine atom allows for further functionalization through nucleophilic substitution reactions. Overall, this compound is of interest in medicinal chemistry and materials science due to its diverse applications and reactivity.
Formula:C7H5BrF3NO
InChI:InChI=1S/C7H5BrF3NO/c1-13-5-2-6(8)12-3-4(5)7(9,10)11/h2-3H,1H3
InChI key:InChIKey=IRNAIICCZZKNRQ-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C(OC)=CC(Br)=NC1
Synonyms:
  • 2-Bromo-4-methoxy-5-(trifluoromethyl)pyridine
  • Pyridine, 2-bromo-4-methoxy-5-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.