CAS 1227580-90-6

2-Chloro-3-iodo-6-methoxypyridine

Description:

2-Chloro-3-iodo-6-methoxypyridine is a heterocyclic organic compound characterized by its pyridine ring, which contains various substituents that influence its chemical properties and reactivity. The presence of chlorine and iodine atoms introduces halogen functionalities, which can enhance the compound's reactivity in nucleophilic substitution reactions. The methoxy group (-OCH3) at the 6-position contributes to the compound's polarity and can affect its solubility in organic solvents. This compound is typically used in medicinal chemistry and material science due to its potential biological activity and utility as an intermediate in the synthesis of other complex molecules. Its molecular structure allows for various interactions, making it a candidate for further research in drug development and agrochemical applications. Additionally, the presence of multiple halogens may impart unique electronic properties, influencing its behavior in chemical reactions. Safety and handling precautions should be observed due to the potential toxicity associated with halogenated compounds.

Formula: C₆H₅ClINO

InChI: InChI=1S/C6H5ClINO/c1-10-5-3-2-4(8)6(7)9-5/h2-3H,1H3

InChI key: InChIKey=YQFZMBLOJHPSAS-UHFFFAOYSA-N

SMILES: O(C)C=1N=C(Cl)C(I)=CC1

Synonyms:

• 2-Chloro-3-iodo-6-methoxypyridine
• Pyridine, 2-chloro-3-iodo-6-methoxy-