CymitQuimica logo

CAS 1227581-04-5

:

2-Iodo-4-methoxy-3-methylpyridine

Description:
2-Iodo-4-methoxy-3-methylpyridine is a heterocyclic organic compound characterized by its pyridine ring, which contains various substituents that influence its chemical properties. The presence of an iodine atom at the 2-position introduces significant reactivity, particularly in nucleophilic substitution reactions, while the methoxy group at the 4-position enhances the compound's electron-donating characteristics, potentially affecting its reactivity and solubility. The methyl group at the 3-position contributes to steric hindrance, which can influence the compound's interactions with other molecules. This compound is typically used in organic synthesis and medicinal chemistry, where its unique structure may serve as a building block for more complex molecules or as a precursor in the development of pharmaceuticals. Its physical properties, such as melting point, boiling point, and solubility, are influenced by the functional groups present and the overall molecular structure. Additionally, the compound's reactivity can be modulated by the presence of the iodine atom, making it a valuable intermediate in various chemical reactions.
Formula:C7H8INO
InChI:InChI=1S/C7H8INO/c1-5-6(10-2)3-4-9-7(5)8/h3-4H,1-2H3
InChI key:InChIKey=FFXKOSFBOAIEEH-UHFFFAOYSA-N
SMILES:O(C)C=1C(C)=C(I)N=CC1
Synonyms:
  • Pyridine, 2-iodo-4-methoxy-3-methyl-
  • 2-Iodo-4-methoxy-3-methylpyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.