CAS 1227581-33-0

2-Chloro-3-methyl-4-pyridineacetic acid

Description:

2-Chloro-3-methyl-4-pyridineacetic acid is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a chloro substituent at the second position and a methyl group at the third position of the pyridine ring, along with a carboxylic acid functional group at the fourth position. The presence of these functional groups contributes to its potential reactivity and solubility in various solvents. Typically, compounds like this may exhibit biological activity, making them of interest in pharmaceutical research. The molecular structure suggests that it may participate in hydrogen bonding due to the carboxylic acid group, influencing its interactions with other molecules. Additionally, the chlorine atom can affect the compound's electronic properties and stability. As with many pyridine derivatives, this compound may also exhibit unique properties such as moderate to high polarity, which can affect its behavior in chemical reactions and applications.

Formula: C₈H₈ClNO₂

InChI: InChI=1S/C8H8ClNO2/c1-5-6(4-7(11)12)2-3-10-8(5)9/h2-3H,4H2,1H3,(H,11,12)

InChI key: InChIKey=WKWLIZARRIDYMX-UHFFFAOYSA-N

SMILES: C(C(O)=O)C=1C(C)=C(Cl)N=CC1

Synonyms:

• 4-Pyridineacetic acid, 2-chloro-3-methyl-
• 2-Chloro-3-methyl-4-pyridineacetic acid