CymitQuimica logo

CAS 1227581-37-4

:

2-Chloro-3-methyl-4-pyridineacetonitrile

Description:
2-Chloro-3-methyl-4-pyridineacetonitrile is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a chloro substituent at the second position and a methyl group at the third position of the pyridine ring, along with a nitrile functional group (-C≡N) attached to the fourth position. The presence of the nitrile group indicates that it may exhibit polar characteristics, contributing to its solubility in polar solvents. The chloro group can influence the reactivity of the compound, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. This compound may be of interest in pharmaceutical research and synthesis due to its unique structural features, which could impart specific biological activities. Additionally, its molecular structure suggests potential applications in agrochemicals or as an intermediate in organic synthesis. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information.
Formula:C8H7ClN2
InChI:InChI=1S/C8H7ClN2/c1-6-7(2-4-10)3-5-11-8(6)9/h3,5H,2H2,1H3
InChI key:InChIKey=KHCSYMVCKUJPMT-UHFFFAOYSA-N
SMILES:C(C#N)C=1C(C)=C(Cl)N=CC1
Synonyms:
  • 4-Pyridineacetonitrile, 2-chloro-3-methyl-
  • 2-Chloro-3-methyl-4-pyridineacetonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.