CAS 1227581-39-6: Methyl 3-amino-2-methyl-4-pyridinecarboxylate
Description:Methyl 3-amino-2-methyl-4-pyridinecarboxylate is an organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an amino group (-NH2) and a carboxylate ester functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the methyl groups enhances its lipophilicity, which may influence its solubility and biological activity. As a pyridine derivative, it may exhibit properties such as basicity due to the nitrogen atom in the ring. The compound's structure suggests potential uses in pharmaceuticals, agrochemicals, or as intermediates in chemical synthesis. Its specific characteristics, such as melting point, boiling point, and spectral data, would typically be determined through experimental methods. Additionally, safety data sheets would provide information on handling, storage, and potential hazards associated with this substance. Overall, Methyl 3-amino-2-methyl-4-pyridinecarboxylate represents a versatile compound with implications in various chemical fields.
Formula:C8H10N2O2
InChI:InChI=1S/C8H10N2O2/c1-5-7(9)6(3-4-10-5)8(11)12-2/h3-4H,9H2,1-2H3
InChI key:InChIKey=WKDCUNZSNDZNHH-UHFFFAOYSA-N
SMILES:O=C(OC)C=1C=CN=C(C1N)C
- Synonyms:
- 4-Pyridinecarboxylic acid, 3-amino-2-methyl-, methyl ester
- Methyl 3-amino-2-methyl-4-pyridinecarboxylate
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 4-Pyridinecarboxylic acid, 3-aMino-2-Methyl-, Methyl ester REF: IN-DA000JCXCAS: 1227581-39-6 | 97% | To inquire | Mon 24 Mar 25 |
 | Methyl 3-amino-2-methylisonicotinate REF: 54-OR53145CAS: 1227581-39-6 | 97% | 405.00 €~1,048.00 € | Mon 31 Mar 25 |
 | Methyl 3-amino-2-methylisonicotinate REF: 10-F498130CAS: 1227581-39-6 | 95.0% | - - - | Discontinued product |
 | Methyl 3-amino-2-methylpyridine-4-carboxylate REF: 3D-FM138518CAS: 1227581-39-6 | Min. 95% | - - - | Discontinued product |
4-Pyridinecarboxylic acid, 3-aMino-2-Methyl-, Methyl ester
Ref: IN-DA000JCX
| Undefined size | To inquire |
Ref: 54-OR53145
| 1g | 405.00 € | ||
| 5g | 1,048.00 € |
Ref: 10-F498130
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 250mg | Discontinued | Request information |
Methyl 3-amino-2-methylpyridine-4-carboxylate
Ref: 3D-FM138518
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
