CAS 1227581-63-6

Methyl 2-methoxy-4-(trifluoromethyl)-3-pyridinecarboxylate

Description:

Methyl 2-methoxy-4-(trifluoromethyl)-3-pyridinecarboxylate is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features a methoxy group (-OCH3) and a trifluoromethyl group (-CF3) attached to the pyridine ring, contributing to its unique chemical properties. The presence of the trifluoromethyl group enhances the compound's lipophilicity and can influence its reactivity and biological activity. Methyl 2-methoxy-4-(trifluoromethyl)-3-pyridinecarboxylate is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents, which makes it useful in various chemical reactions and applications, including pharmaceuticals and agrochemicals. The compound's structure allows for potential interactions in biological systems, making it of interest in medicinal chemistry. Safety data should be consulted for handling, as the trifluoromethyl group can impart specific toxicological properties.

Formula: C₉H₈F₃NO₃

InChI: InChI=1S/C9H8F3NO3/c1-15-7-6(8(14)16-2)5(3-4-13-7)9(10,11)12/h3-4H,1-2H3

InChI key: InChIKey=LKQCJEUNRONKRN-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C(C(F)(F)F)=CC=NC1OC

Synonyms:

• 3-Pyridinecarboxylic acid, 2-methoxy-4-(trifluoromethyl)-, methyl ester
• Methyl 2-methoxy-4-(trifluoromethyl)-3-pyridinecarboxylate