CAS 1227581-75-0

2-Amino-4-(trifluoromethyl)-3-pyridinol

Description:

2-Amino-4-(trifluoromethyl)-3-pyridinol is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an amino group (-NH2) and a trifluoromethyl group (-CF3) attached to the pyridine ring, specifically at the 2 and 4 positions, respectively. The presence of the trifluoromethyl group significantly influences its chemical properties, enhancing lipophilicity and potentially altering its reactivity and biological activity. The amino group contributes to its basicity and potential for hydrogen bonding. This compound is of interest in various fields, including medicinal chemistry and agrochemicals, due to its potential applications in drug development and as a building block for synthesizing more complex molecules. Its unique electronic and steric properties make it a subject of study for researchers exploring new therapeutic agents or functional materials. Safety and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with its use.

Formula: C₆H₅F₃N₂O

InChI: InChI=1S/C6H5F3N2O/c7-6(8,9)3-1-2-11-5(10)4(3)12/h1-2,12H,(H2,10,11)

InChI key: InChIKey=PBNWOTSQTJJQPH-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C(O)=C(N)N=CC1

Synonyms:

• 3-Pyridinol, 2-amino-4-(trifluoromethyl)-
• 2-Amino-3-hydroxy-4-(trifluoromethyl)pyridine
• 2-Amino-4-(trifluoromethyl)-3-pyridinol