CAS 1227582-11-7

2-Amino-4-(trifluoromethyl)-3-pyridinecarboxaldehyde

Description:

2-Amino-4-(trifluoromethyl)-3-pyridinecarboxaldehyde is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of an amino group (-NH2) and a trifluoromethyl group (-CF3) significantly influences its chemical properties and reactivity. The aldehyde functional group (-CHO) contributes to its potential as a reactive intermediate in various organic synthesis reactions. This compound is typically used in pharmaceutical research and development due to its unique electronic properties imparted by the trifluoromethyl group, which can enhance biological activity. Additionally, the presence of the amino group allows for further derivatization, making it a versatile building block in the synthesis of more complex molecules. Its solubility and stability can vary depending on the solvent and conditions, and it may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₇H₅F₃N₂O

InChI: InChI=1S/C7H5F3N2O/c8-7(9,10)5-1-2-12-6(11)4(5)3-13/h1-3H,(H2,11,12)

InChI key: InChIKey=DZJLHULPSXPKRN-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C(C=O)=C(N)N=CC1

Synonyms:

• 3-Pyridinecarboxaldehyde, 2-amino-4-(trifluoromethyl)-
• 2-Amino-4-(trifluoromethyl)-3-pyridinecarboxaldehyde