CAS 1227584-38-4
:2,3-Dibromo-4-pyridinemethanol
Description:
2,3-Dibromo-4-pyridinemethanol is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of two bromine substituents at the 2 and 3 positions of the pyridine ring, along with a hydroxymethyl group (-CH2OH) at the 4 position, contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the hydroxyl group, which can engage in hydrogen bonding. The bromine atoms enhance the compound's reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the presence of the pyridine moiety may impart basicity and influence the compound's interaction with biological systems, suggesting potential applications in pharmaceuticals or agrochemicals. Safety data should be consulted, as brominated compounds can pose environmental and health risks. Overall, 2,3-Dibromo-4-pyridinemethanol is a versatile compound with significant implications in synthetic chemistry and material science.
Formula:C6H5Br2NO
InChI:InChI=1S/C6H5Br2NO/c7-5-4(3-10)1-2-9-6(5)8/h1-2,10H,3H2
InChI key:InChIKey=WYIOZEUTWFWWAB-UHFFFAOYSA-N
SMILES:C(O)C=1C(Br)=C(Br)N=CC1
Synonyms:- 2,3-Dibromo-4-pyridinemethanol
- 4-Pyridinemethanol, 2,3-dibromo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
